missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cupriethylenediamine, Certified, 1.00M ±0.02M, LabChem™
$249.17 - $733.07
Chemical Identifiers
| CAS | 13426-91-0 |
|---|---|
| Molecular Formula | C4H12CuN4-2 |
| Molecular Weight (g/mol) | 179.714 |
| InChI Key | GOYYUYNOGNSLTE-UHFFFAOYSA-N |
| Synonym | copper-ethylenediamine complex, cupriethylene diamine, bis 1,2-ethanediamine-n,n' copper 2+, koplex aquatic herbicide, unii-nip4i4lvcc, cupriethylenediamine, bis ethylenediamine copper ion, bis ethylenediamine copper 2+, bis ethylenediamine copper 2+ ion, ethane, 1,2-diamino-, copper complex |
| PubChem CID | 4578819 |
| IUPAC Name | copper;2-azanidylethylazanide |
| SMILES | C(C[NH-])[NH-].C(C[NH-])[NH-].[Cu+2] |
Chemical Identifiers
| 13426-91-0 | |
| 179.714 | |
| copper-ethylenediamine complex, cupriethylene diamine, bis 1,2-ethanediamine-n,n' copper 2+, koplex aquatic herbicide, unii-nip4i4lvcc, cupriethylenediamine, bis ethylenediamine copper ion, bis ethylenediamine copper 2+, bis ethylenediamine copper 2+ ion, ethane, 1,2-diamino-, copper complex | |
| copper;2-azanidylethylazanide |
| C4H12CuN4-2 | |
| GOYYUYNOGNSLTE-UHFFFAOYSA-N | |
| 4578819 | |
| C(C[NH-])[NH-].C(C[NH-])[NH-].[Cu+2] |
Specifications
| 13426-91-0,7732-18-5 | |
| 77.5,22.5 | |
| 1 L | |
| C4H16CuN4 | |
| copper-ethylenediamine complex, cupriethylene diamine, bis 1,2-ethanediamine-n,n' copper 2+, koplex aquatic herbicide, unii-nip4i4lvcc, cupriethylenediamine, bis ethylenediamine copper ion, bis ethylenediamine copper 2+, bis ethylenediamine copper 2+ ion, ethane, 1,2-diamino-, copper complex | |
| GOYYUYNOGNSLTE-UHFFFAOYSA-N | |
| copper;2-azanidylethylazanide | |
| 4578819 | |
| Certified | |
| Passes Test | |
| 1.1g/mL | |
| 1.1g/mL |
| Blue | |
| Liquid | |
| C4H12CuN4-2 | |
| UN1761 | |
| Soluble in water | |
| C(C[NH-])[NH-].C(C[NH-])[NH-].[Cu+2] | |
| 179.714 | |
| 183.74 | |
| 1.00M ±0.02M | |
| Amber Glass | |
| Carbon monoxide; Carbon dioxide; Copper | |
| Cupriethylenediamine |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
May cause respiratory irritation.
GHS P Statement
Do not breathe mist, vapors, spray.
Use only outdoors or in a well-ventilated area.
Wear protective gloves, protective clothing, eye protection, face protection.
Wash exposed skin thoroughly after handling.
Store in a well-ventilated place.
Keep container tightly closed.
If swallowed: Rinse mouth.
Do not induce vomiting.
Immediately call a poison center/doctor.
If on skin (or hair): Remove immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a poison center/doctor.
Wash contaminated clothing before reuse.
If inhaled: Remove person to fresh air and keep comfortable for breathing.
Immediately call a poison center/doctor.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
Immediately call a poison center/doctor.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
Recommended Storage : Refrigerate