missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Crystal Violet (Certified Biological Stain), Fisher Chemical™
For use in histology, cytology and bacteriology (staining)
Supplier: Thermo Fisher Scientific FLC58125
| Quantity | 25 g |
|---|---|
| Packaging | Glass Bottle |
Chemical Identifiers
| 548-62-9 | |
| 407.986 | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| 11057 | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| C25H30ClN3 | |
| MFCD00011750 | |
| Gentian Violet, Basic Violet 3 | |
| CHEBI:41688 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
Specifications
| Crystal Violet | |
| Pass Test | |
| C25H30ClN3 | |
| Gentian Violet, Basic Violet 3 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| 407.986 | |
| CHEBI:41688 | |
| Certified Biological Stain | |
| 42555 | |
| 25 g |
| 548-62-9 | |
| Report % | |
| MFCD00011750 | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride | |
| 11057 | |
| 407.98 | |
| Glass Bottle | |
| Green | |
| Solid |
Safety and Handling