missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Cresol Red, pure, Indicator grade
CAS: 1733-12-6 | C21H18O5S | 382.43 g/mol
Supplier: Thermo Scientific Chemicals 151380250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorSpecifications
| Cresol Red | |
| 1733-12-6 | |
| MFCD00005878 | |
| 15, 2568 | |
| OBRMNDMBJQTZHV-UHFFFAOYSA-N | |
| CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 | |
| 382.43 | |
| CHEBI:86218 | |
| Pure | |
| 1500 min. (572nm, in 0.01N NaOH) | |
| Brown/Red or Green | |
| Powder |
| 290.0°C | |
| C21H18O5S | |
| 19, 91 | |
| Solubility in water: soluble. Other solubilities: soluble in dil. acids, dil. alkalies and ethanol,, insoluble in diethyl ether, benzene | |
| Authentic | |
| 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol | |
| 73013 | |
| 382.42 | |
| Glass bottle | |
| from pH 7.0 (orange) to pH 8.8 (purple) | |
| 25 g |
Chemical Identifiers
| 1733-12-6 | |
| 382.43 | |
| OBRMNDMBJQTZHV-UHFFFAOYSA-N | |
| CHEBI:86218 | |
| CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| C21H18O5S | |
| MFCD00005878 | |
| 73013 | |
| 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol |
RUO – Research Use Only