missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Congo Red, Reagent Grade, LabChem™
Supplier: LabChem LC133507
| Quantity | 10 g |
|---|
Chemical Identifiers
| 573-58-0 | |
| 696.664 | |
| 11313 | |
| disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
| C32H22N6Na2O6S2 | |
| IQFVPQOLBLOTPF-UHFFFAOYSA-L | |
| CHEBI:34653 | |
| C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] |
Specifications
| Congo Red | |
| 573-58-0 | |
| C32H22N6Na2O6S2 | |
| Soluble in water | |
| IQFVPQOLBLOTPF-UHFFFAOYSA-L | |
| disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate | |
| 11313 | |
| 696.67 | |
| Amber Glass | |
| Red | |
| Powder |
| 360°C | |
| 100 | |
| C32H22N6O6S2Na2 | |
| Passes Test | |
| C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] | |
| 696.664 | |
| CHEBI:34653 | |
| Reagent | |
| Nitrogen oxides; Sulfur compounds; Fume; Carbon monoxide; Carbon dioxide | |
| 10 g |
Safety and Handling
GHS H Statement
May cause cancer.
Suspected of damaging fertility or the unborn child.
GHS P Statement
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Wear protective gloves, eye protection.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
If exposed or concerned: Get medical advice/attention.
Danger
EINECSNumber : 209-358-4
Recommended Storage : Room Temperature