missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Congo Red, Indicator grade
CAS: 573-58-0 | C32H22N6Na2O6S2 | 696.664 g/mol
Supplier: Thermo Scientific Chemicals 110501000
| Quantity | 100 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 573-58-0 | |
| 696.664 | |
| IQFVPQOLBLOTPF-UHFFFAOYSA-L | |
| 11313 | |
| disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
| C32H22N6Na2O6S2 | |
| MFCD00004028 | |
| C.I. 22120, Direct Red 28 | |
| CHEBI:34653 | |
| C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] |
Specifications
| Congo Red | |
| 573-58-0 | |
| MFCD00004028 | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol, slightly soluble in acetone, practically insoluble in ether | |
| C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] | |
| 696.664 | |
| CHEBI:34653 | |
| Indicator | |
| 100 g |
| >360.0°C | |
| C32H22N6Na2O6S2 | |
| C.I. 22120, Direct Red 28 | |
| IQFVPQOLBLOTPF-UHFFFAOYSA-L | |
| disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate | |
| 11313 | |
| 696.65 | |
| Glass bottle |