missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric Acid Monohydrate, TraceSELECT™, ≥99.9998% (Metals basis), Honeywell™ Fluka™
TraceSELECT™,≥99.9998% (metals basis)
Supplier: Honeywell-Fluka 94068100G
Description
TraceSELECT™ Ultra and TraceSELECT
- ultra-pure acids, bases, and salts for smelting and wet digestion in environmental, water, and food analysis
- sample preparation for trace analysis requires reagents of the highest purity; our TraceSELECT Ultra products for ultra-trace analysis at ppb and even ppt levels are produced by sub-boiling distillation
- the acids, bases, and salts in the TraceSELECT series have been developed for sample preparation and analysis in the ppb (μg/kg) trace range
- packaged in high-quality containers appropriate for each product
- the reagents are produced and bottled under clean-room conditions
Specifications
| Citric acid monohydrate | |
| ∼135°C to 152°C | |
| White | |
| HOC(COOH)(CH2COOH)2 · H2O | |
| NONH for all modes of transport | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O | |
| 210.138 | |
| CHEBI:31404 | |
| ≥99.9998% (metals basis) | |
| ∽1.54g/cu.cm at 20°C | |
| 173°C (343.4°F) | |
| Poly bottle |
| 1.8 (at 50.00g/L 20°C) | |
| 5949-29-1 | |
| C6H10O8 | |
| MFCD00149972 | |
| 4018641 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate | |
| 22230 | |
| 210.14g/mol | |
| TraceSELECT™ | |
| 100 g | |
| Odorless | |
| Crystalline |
Chemical Identifiers
| 5949-29-1 | |
| 210.138 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 22230 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| C6H10O8 | |
| MFCD00149972 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| CHEBI:31404 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
Safety and Handling
P305 + P351 + P338
RTECSNumber : 201-069-1