missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric Acid Monohydrate, Honeywell Fluka™
Tested according to European Pharmacopoeia
Supplier: Honeywell-Fluka 274911KG
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Citric Acid Monohydrate | |
| 5949-29-1 | |
| HOC(COOH)(CH2COOH)2 · H2O | |
| NONH for all modes of transport | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate | |
| 22230 | |
| 210.14g/mol | |
| 173°C (343.4°F) |
| Tested according to Ph.Eur. | |
| C6H10O8 | |
| MFCD00149972 | |
| 4018641 | |
| Soluble in ethyl acetate (5.28g/100g), Amyl Acetate(5.98g/100g), diethyl ether(2.17g/100g), methanol(197g/100g), chloroform(0.007g/100 g) | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O | |
| 210.138 | |
| CHEBI:31404 | |
| 1 kg |
Chemical Identifiers
| 5949-29-1 | |
| 210.138 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 22230 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| C6H10O8 | |
| MFCD00149972 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| CHEBI:31404 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
Safety and Handling
P305 + P351 + P338
H319
EINECSNumber : 201-069-1
RTECSNumber : GE7810000