missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Citric Acid Monohydrate (Granular/USP), Fisher Chemical™
$902.86 - $2180.86
Chemical Identifiers
| CAS | 5949-29-1 |
|---|---|
| Molecular Formula | C6H10O8 |
| Molecular Weight (g/mol) | 210.138 |
| MDL Number | MFCD00149972 |
| InChI Key | YASYEJJMZJALEJ-UHFFFAOYSA-N |
| Synonym | citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp |
| PubChem CID | 22230 |
| ChEBI | CHEBI:31404 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
A110-3
|
Thermo Fisher Scientific
FLA1103 |
3 kg | Poly Bottle |
Each for $902.86
Case of 4 Each for $3,611.44
|
|
||||
|
A110-10
|
Thermo Fisher Scientific
FLA11010 |
10 kg | Poly Pail |
Each for $2,180.86
|
|
||||
Chemical Identifiers
| 5949-29-1 | |
| 210.138 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 22230 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
| C6H10O8 | |
| MFCD00149972 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| CHEBI:31404 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
Specifications
| 2.2 | |
| 5949-29-1 | |
| White | |
| MFCD00149972 | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate | |
| 22230 | |
| 210.14 | |
| USP | |
| 3 kg | |
| 0.1% max. (USP) | |
| Solid |
| 135°C to 152°C | |
| 175°C | |
| C6H10O8 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O | |
| 210.138 | |
| CHEBI:31404 | |
| 99.5 to 100.5% (USP) | |
| 1.54g/mL | |
| 174°C | |
| Poly Bottle | |
| Citric Acid Monohydrate |
Safety and Handling
WARNING!
Emergency Overview
Risk of serious damage to eyes. Use personal protective equipment. Ensure adequate ventilation. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Immediate medical attention is required. Move to fresh air. If breathing is difficult, give oxygen. Obtain medical attention. Do not induce vomiting. Obtain medical attention. Obtain medical attention. .
NFPA
Health:2
Flammability:1
Instability:0