Learn More
Citric acid monohydrate, 99+%, ACS reagent
CAS: 5949-29-1 | C6H8O7·H2O | 210.15 g/mol
Supplier: Thermo Scientific Chemicals 385850025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Citric acid monohydrate | |
| 135.0°C to 152.0°C | |
| 0.02% max | |
| Plastic bottle | |
| HO2CCH2C(OH)(CO2H)CH2CO2H·H2O | |
| 15,2325 | |
| Solubility in water: 676g/L (25°C). Other solubilities: 2.17g/100g ether - 0.007g/100g chloroform, 15.43g/100g amyl alcohol - 5.98g/100g amyl acetate, 5.28g/100g ethyl acetate - 197g/100g methanol, 62.8g/100g propanol | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O | |
| 210.15 | |
| CHEBI:31404 | |
| 99+% | |
| 0.005% max |
| 5949-29-1 | |
| 174°C | |
| 99+% | |
| C6H8O7·H2O | |
| 2.5 kg | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate | |
| 22230 | |
| 210.15 | |
| ACS Reagent |
Chemical Identifiers
| 5949-29-1 | |
| 210.15 | |
| citric acid monohydrate, citric acid hydrate, 2-hydroxypropane-1,2,3-tricarboxylic acid hydrate, citric acid, monohydrate, unii-2968phw8qp, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, monohydrate, citrate, acidum citricum monohydricum, citric acid monohydrate usp | |
| CHEBI:31404 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O.O |
| C6H8O7·H2O | |
| YASYEJJMZJALEJ-UHFFFAOYSA-N | |
| 22230 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid;hydrate |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact len
GHS Signal Word: Warning
RUO – Research Use Only