Learn More
Thermo Scientific Chemicals Cinchonine, 99%
CAS: 118-10-5 | C19H22N2O | 294.40 g/mol
Supplier: Thermo Scientific Chemicals 227811000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Cinchonine | |
| 255.0°C to 265.0°C | |
| 1.0% max. | |
| 99% | |
| C19H22N2O | |
| 100 g | |
| 06,501; 13,264 | |
| +251.00 (20.00°C c=2,0.2M HCl) | |
| +-quinolin-4-yl 5-vinylquinuclidin-2-yl methanol, 5r-5-vinylquinuclidin-2-yl 1s-4-quinolylmethan-1-ol | |
| KMPWYEUPVWOPIM-FRYPIZGFNA-N | |
| [(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol | |
| 21862290 | |
| 99% |
| 118-10-5 | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00064372 | |
| 23, V,12, 406 | |
| 15,229 | |
| + 251.00 | |
| Solubility in water: insoluble. Other solubilities: 1g/60mL alcohol - 1g/25mL boiling alcohol, 1g/110mL chloroform - 1g/500mL ether | |
| [H][C@@]1(CN2CCC1C[C@]2([H])[C@@H](O)C1=CC=NC2=CC=CC=C12)C=C | |
| 294.40 | |
| 294.4 | |
| Micro-crystalline Powder |
Chemical Identifiers
| 118-10-5 | |
| 294.40 | |
| KMPWYEUPVWOPIM-FRYPIZGFNA-N | |
| 21862290 | |
| [H][C@@]1(CN2CCC1C[C@]2([H])[C@@H](O)C1=CC=NC2=CC=CC=C12)C=C |
| C19H22N2O | |
| MFCD00064372 | |
| +-quinolin-4-yl 5-vinylquinuclidin-2-yl methanol, 5r-5-vinylquinuclidin-2-yl 1s-4-quinolylmethan-1-ol | |
| [(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If s
GHS Signal Word: Warning
EINECSNumber : 204-234-6
RUO – Research Use Only