Learn More
Thermo Scientific Chemicals Cinchonine, 99%
CAS: 118-10-5 | C19H22N2O | 294.40 g/mol
$90.15 - $247.89
Chemical Identifiers
| CAS | 118-10-5 |
|---|---|
| Molecular Formula | C19H22N2O |
| Molecular Weight (g/mol) | 294.40 |
| MDL Number | MFCD00064372 |
| InChI Key | KMPWYEUPVWOPIM-FRYPIZGFNA-N |
| Synonym | +-quinolin-4-yl 5-vinylquinuclidin-2-yl methanol, 5r-5-vinylquinuclidin-2-yl 1s-4-quinolylmethan-1-ol |
| PubChem CID | 21862290 |
| IUPAC Name | [(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | [H][C@@]1(CN2CCC1C[C@]2([H])[C@@H](O)C1=CC=NC2=CC=CC=C12)C=C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC227810250
|
Thermo Scientific Chemicals
227810250 |
25 g | Glass bottle |
Each for $90.15
|
|
||||
|
AC227811000
|
Thermo Scientific Chemicals
227811000 |
100 g | Glass bottle |
Each for $247.89
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 118-10-5 | |
| 294.40 | |
| KMPWYEUPVWOPIM-FRYPIZGFNA-N | |
| 21862290 | |
| [H][C@@]1(CN2CCC1C[C@]2([H])[C@@H](O)C1=CC=NC2=CC=CC=C12)C=C |
| C19H22N2O | |
| MFCD00064372 | |
| +-quinolin-4-yl 5-vinylquinuclidin-2-yl methanol, 5r-5-vinylquinuclidin-2-yl 1s-4-quinolylmethan-1-ol | |
| [(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
Specifications
| 118-10-5 | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00064372 | |
| 23, V,12, 406 | |
| 15,229 | |
| + 251.00 | |
| Solubility in water: insoluble. Other solubilities: 1g/60mL alcohol - 1g/25mL boiling alcohol, 1g/110mL chloroform - 1g/500mL ether | |
| [H][C@@]1(CN2CCC1C[C@]2([H])[C@@H](O)C1=CC=NC2=CC=CC=C12)C=C | |
| 294.40 | |
| 294.4 | |
| Micro-crystalline Powder |
| 255.0°C to 265.0°C | |
| 1.0% max. | |
| 99% | |
| C19H22N2O | |
| 25 g | |
| 06,501; 13,264 | |
| +251.00 (20.00°C c=2,0.2M HCl) | |
| +-quinolin-4-yl 5-vinylquinuclidin-2-yl methanol, 5r-5-vinylquinuclidin-2-yl 1s-4-quinolylmethan-1-ol | |
| KMPWYEUPVWOPIM-FRYPIZGFNA-N | |
| [(5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol | |
| 21862290 | |
| 99% | |
| Cinchonine |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If s
GHS Signal Word: Warning
EINECSNumber : 204-234-6
RUO – Research Use Only