Learn More
chlorodiphenylmethane, 98%
CAS: 90-99-3 | C13H11Cl | 202.68 g/mol
Supplier: Thermo Scientific Chemicals 154660500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Chlorodiphenylmethane | |
| 15°C to 17°C | |
| 1.1400g/mL | |
| >110°C | |
| 97.5% min. (GC) | |
| C13H11Cl | |
| (C6H5)2CHCl | |
| 50 mL | |
| benzhydryl chloride, chlorodiphenylmethane, chloromethylene dibenzene, diphenylchloromethane, diphenylmethyl chloride, benzene, 1,1'-chloromethylene bis, chloro phenyl methyl benzene, methane, chlorodiphenyl, unii-cn9n9ayv4b, 1,1'-chloromethylene bisbenzene | |
| ZDVDCDLBOLSVGM-UHFFFAOYSA-N | |
| [chloro(phenyl)methyl]benzene | |
| 7035 | |
| 98% |
| 90-99-3 | |
| Colorless to Yellow | |
| 270°C | |
| Authentic | |
| Glass bottle | |
| 1.5940 to 1.597 | |
| MFCD00000855 | |
| 1.14 | |
| Solubility in water: slightly soluble | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl | |
| 202.68 | |
| 202.68 | |
| Liquid |
Chemical Identifiers
| 90-99-3 | |
| 202.68 | |
| ZDVDCDLBOLSVGM-UHFFFAOYSA-N | |
| 7035 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl |
| C13H11Cl | |
| MFCD00000855 | |
| benzhydryl chloride, chlorodiphenylmethane, chloromethylene dibenzene, diphenylchloromethane, diphenylmethyl chloride, benzene, 1,1'-chloromethylene bis, chloro phenyl methyl benzene, methane, chlorodiphenyl, unii-cn9n9ayv4b, 1,1'-chloromethylene bisbenzene | |
| [chloro(phenyl)methyl]benzene |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
May be corrosive to metals.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Danger
EINECSNumber : 202-031-7
RUO – Research Use Only