missing translation for 'onlineSavingsMsg'
Learn More
Learn More
chlorodiisopropylsilane, 95%
CAS: 2227-29-4 | C6H14ClSi | 149.71 g/mol
Supplier: Thermo Scientific Chemicals 313440050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| chlorodiisopropylsilane | |
| Colorless | |
| 137.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4280 to 1.4300 (20°C, 589nm) | |
| 5 g | |
| 15,2136 | |
| Solubility in water: reacts | |
| CC(C)[Si](Cl)C(C)C | |
| 149.71 | |
| 150.73 | |
| Liquid |
| 2227-29-4 | |
| 0.8720g/mL | |
| 22°C | |
| 94% min. (GC) | |
| C6H14ClSi | |
| MFCD00054896 | |
| 0.872 | |
| chlorodiisopropylsilane, diisopropylchlorosilane, unii-dvg177547j, silane, chloro diisopropyl, zlchem 966, chlorodiisopropylsilyl, chlorobis propan-2-yl silane, chloro-di propan-2-yl silicon | |
| IGSUJBNDAWQLST-UHFFFAOYSA-N | |
| chloro-di(propan-2-yl)silicon | |
| 6365034 | |
| 95% |
Chemical Identifiers
| 2227-29-4 | |
| 149.71 | |
| IGSUJBNDAWQLST-UHFFFAOYSA-N | |
| 6365034 | |
| CC(C)[Si](Cl)C(C)C |
| C6H14ClSi | |
| MFCD00054896 | |
| chlorodiisopropylsilane, diisopropylchlorosilane, unii-dvg177547j, silane, chloro diisopropyl, zlchem 966, chlorodiisopropylsilyl, chlorobis propan-2-yl silane, chloro-di propan-2-yl silicon | |
| chloro-di(propan-2-yl)silicon |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Highly flammable liquid and vapour.
Contact with water liberates toxic gas.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Handle under inert gas.
Protect from moisture.
Keep away from heat/spa
GHS Signal Word: Danger
RUO – Research Use Only