missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cesium sulfate, Puratronic™, 99.997% (metals basis)
CAS: 10294-54-9 | Cs2O4S | 361.87 g/mol
$159.40 - $600.21
Chemical Identifiers
| CAS | 10294-54-9 |
|---|---|
| Molecular Formula | Cs2O4S |
| Molecular Weight (g/mol) | 361.87 |
| MDL Number | MFCD00010959 |
| InChI Key | FLJPGEWQYJVDPF-UHFFFAOYSA-L |
| Synonym | cesium sulfate, dicesium sulfate, sulfuric acid, dicesium salt, caesium sulphate, caesium sulfate, unii-8d6r91cs62, dicaesium 1+ ion sulfate, cesiumsulfate, dicaesium 1+ sulfate |
| PubChem CID | 25137 |
| IUPAC Name | dicesium;sulfate |
| SMILES | [Cs+].[Cs+].[O-]S([O-])(=O)=O |
Description
Cesium sulfate is used to prepare dense aqueous solutions for use in isopycnic centrifugation. It is also used for crystal growing purposes.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 10294-54-9 | |
| 361.87 | |
| FLJPGEWQYJVDPF-UHFFFAOYSA-L | |
| 25137 | |
| [Cs+].[Cs+].[O-]S([O-])(=O)=O |
| Cs2O4S | |
| MFCD00010959 | |
| cesium sulfate, dicesium sulfate, sulfuric acid, dicesium salt, caesium sulphate, caesium sulfate, unii-8d6r91cs62, dicaesium 1+ ion sulfate, cesiumsulfate, dicaesium 1+ sulfate | |
| dicesium;sulfate |
Specifications
| 1,010°C | |
| White | |
| 10 g | |
| Cs2SO4 | |
| 14,2016 | |
| Soluble in water (1820g/L). | |
| [Cs+].[Cs+].[O-]S([O-])(=O)=O | |
| 361.87 | |
| 361.87 | |
| Puratronic™ | |
| Hygroscopic | |
| Cesium sulfate |
| 10294-54-9 | |
| Powder | |
| Cs2O4S | |
| MFCD00010959 | |
| cesium sulfate, dicesium sulfate, sulfuric acid, dicesium salt, caesium sulphate, caesium sulfate, unii-8d6r91cs62, dicaesium 1+ ion sulfate, cesiumsulfate, dicaesium 1+ sulfate | |
| FLJPGEWQYJVDPF-UHFFFAOYSA-L | |
| dicesium;sulfate | |
| 25137 | |
| 99.997% | |
| Odorless | |
| 4.243 g/mL | |
| (metals basis) |
Safety and Handling
P201-P202-P260-P264b-P270-P281-P301+P312-P308+P313-P330-P501c
H302-H361f-H373
EINECSNumber : 233-662-6
RTECSNumber : FL0800000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only