Learn More
Cesium carbonate, 99.9% (metals basis)
CAS: 534-17-8 | CCs2O3 | 325.82 g/mol
$45.18 - $993.86
Chemical Identifiers
| CAS | 534-17-8 |
|---|---|
| Molecular Formula | CCs2O3 |
| Molecular Weight (g/mol) | 325.82 |
| MDL Number | MFCD00010957 |
| InChI Key | FJDQFPXHSGXQBY-UHFFFAOYSA-L |
| Synonym | cesium carbonate, dicesium carbonate, caesium carbonate, cesiumcarbonate, carbonic acid, dicesium salt, cs2co3, unii-qqi20a14p4, cesium carbonate cs2co3, carbonic acid, cesium salt 1:2, dicaesium 1+ ion carbonate |
| PubChem CID | 10796 |
| SMILES | [Cs+].[Cs+].[O-]C([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA1092406
|
Thermo Scientific Chemicals
01092406 |
5 g |
Each for $45.18
|
|
|||||
|
AA1092414
|
Thermo Scientific Chemicals
01092414 |
25 g |
Each for $140.07
|
|
|||||
|
AA1092422
|
Thermo Scientific Chemicals
01092422 |
100 g |
Each for $354.82
|
|
|||||
|
AA1092436
|
Thermo Scientific Chemicals
01092436 |
500 g |
Each for $993.86
|
|
|||||
Description
Adiponitrile is used as an intermediate for the synthesis of hexamethylenediamine (diamino-1,6-hexane). This chemical is an important intermediate for the manufacture of synthetic fiber.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Suitable for battery materials development.
Chemical Identifiers
| 534-17-8 | |
| 325.82 | |
| FJDQFPXHSGXQBY-UHFFFAOYSA-L | |
| 10796 |
| CCs2O3 | |
| MFCD00010957 | |
| cesium carbonate, dicesium carbonate, caesium carbonate, cesiumcarbonate, carbonic acid, dicesium salt, cs2co3, unii-qqi20a14p4, cesium carbonate cs2co3, carbonic acid, cesium salt 1:2, dicaesium 1+ ion carbonate | |
| [Cs+].[Cs+].[O-]C([O-])=O |
Specifications
| 610°C (decomposition) | |
| Powder/Granules | |
| 99.9% (metals basis) | |
| MFCD00010957 | |
| cesium carbonate, dicesium carbonate, caesium carbonate, cesiumcarbonate, carbonic acid, dicesium salt, cs2co3, unii-qqi20a14p4, cesium carbonate cs2co3, carbonic acid, cesium salt 1:2, dicaesium 1+ ion carbonate | |
| FJDQFPXHSGXQBY-UHFFFAOYSA-L | |
| dicaesium(1+) carbonate | |
| 10796 | |
| Hygroscopic | |
| Cesium carbonate |
| 534-17-8 | |
| 5 g | |
| CCs2O3 | |
| 4546405 | |
| Freely soluble in water. Soluble in ethanol,dimethylformamide and dimethyl sulfoxide. | |
| [Cs+].[Cs+].[O-]C([O-])=O | |
| 325.82 | |
| 325.82 | |
| 4.072 |
Safety and Handling
P201-P202-P260-P281-P305+P351+P338-P308+P313-P310-P501c
H318-H361f-H373
EINECSNumber : 208-591-9
RTECSNumber : FK9400000
TSCA : Yes
storageNote1 : Hygroscopic
Recommended Storage : Ambient temperatures
RUO – Research Use Only