missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cefixime, 98%, Thermo Scientific Chemicals
$90.32 - $322.69
Chemical Identifiers
| CAS | 79350-37-1 |
|---|---|
| Molecular Formula | C16H15N5O7S2 |
| Molecular Weight (g/mol) | 453.44 |
| MDL Number | MFCD00865020 |
| InChI Key | OKBVVJOGVLARMR-QSWIMTSFSA-N |
| Synonym | cefixime, cefixima, cefiximum, cefixim, cefspan, cephoral, cefixoral, cefiximum latin, suprax, necopen |
| PubChem CID | 5362065 |
| ChEBI | CHEBI:472657 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NC1=NC(=CS1)C(=N\OCC(O)=O)\C(=O)N[C@H]1[C@H]2SCC(C=C)=C(N2C1=O)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC459480010
|
Thermo Scientific Chemicals
459480010 |
1 g |
Each for $90.32
|
|
|||||
|
AC459480050
|
Thermo Scientific Chemicals
459480050 |
5 g |
Each for $322.69
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 79350-37-1 | |
| 453.44 | |
| OKBVVJOGVLARMR-QSWIMTSFSA-N | |
| 5362065 | |
| (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| C16H15N5O7S2 | |
| MFCD00865020 | |
| cefixime, cefixima, cefiximum, cefixim, cefspan, cephoral, cefixoral, cefiximum latin, suprax, necopen | |
| CHEBI:472657 | |
| NC1=NC(=CS1)C(=N\OCC(O)=O)\C(=O)N[C@H]1[C@H]2SCC(C=C)=C(N2C1=O)C(O)=O |
Specifications
| 79350-37-1 | |
| Authentic | |
| Glass Bottle | |
| MFCD00865020 | |
| cefixime, cefixima, cefiximum, cefixim, cefspan, cephoral, cefixoral, cefiximum latin, suprax, necopen | |
| NC1=NC(=CS1)C(=N\OCC(O)=O)\C(=O)N[C@H]1[C@H]2SCC(C=C)=C(N2C1=O)C(O)=O | |
| 453.44 | |
| CHEBI:472657 | |
| 98% |
| 2.6 to 4.1 | |
| 97.5% min. (HPLC) | |
| C16H15N5O7S2 | |
| 1 g | |
| OKBVVJOGVLARMR-QSWIMTSFSA-N | |
| (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | |
| 5362065 | |
| 453.45 | |
| Cefixime |
RUO – Research Use Only