missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(-)-Caryophyllene oxide, 95%
CAS: 1139-30-6 | C15H24O | 220.35 g/mol
$64.77 - $628.20
Chemical Identifiers
| CAS | 1139-30-6 |
|---|---|
| Molecular Formula | C15H24O |
| Molecular Weight (g/mol) | 220.35 |
| MDL Number | MFCD00134216 |
| InChI Key | NVEQFIOZRFFVFW-RGCMKSIDSA-N |
| Synonym | caryophyllene oxide, --caryophyllene oxide, beta-caryophyllene epoxide, beta-caryophyllene oxide, --epoxycaryophyllene, unii-s2xu9k448u, -carophyllene oxide, caryophyllene epoxide, epoxycaryophyllene, trans-caryophyllene oxide |
| PubChem CID | 1742210 |
| ChEBI | CHEBI:67818 |
| SMILES | CC1(CC2C1CCC3(C(O3)CCC2=C)C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC325080100
|
Thermo Scientific Chemicals
325080100 |
10 g | Glass bottle |
Each for $64.77
|
|
||||
|
AC325080500
|
Thermo Scientific Chemicals
325080500 |
50 g | Glass bottle |
Each for $166.50
|
|
||||
|
AC325082500
|
Thermo Scientific Chemicals
325082500 |
250 g | Glass bottle |
Each for $628.20
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1139-30-6 | |
| 220.35 | |
| NVEQFIOZRFFVFW-RGCMKSIDSA-N | |
| 1742210 | |
| CC1(CC2C1CCC3(C(O3)CCC2=C)C)C |
| C15H24O | |
| MFCD00134216 | |
| caryophyllene oxide, --caryophyllene oxide, beta-caryophyllene epoxide, beta-caryophyllene oxide, --epoxycaryophyllene, unii-s2xu9k448u, -carophyllene oxide, caryophyllene epoxide, epoxycaryophyllene, trans-caryophyllene oxide | |
| CHEBI:67818 |
Specifications
| 1139-30-6 | |
| 100.0 | |
| White | |
| >110°C | |
| 94% min. (GC) | |
| C15H24O | |
| MFCD00134216 | |
| 17, IV, 392 | |
| -55 | |
| NVEQFIOZRFFVFW-RGCMKSIDSA-N | |
| 220.35 | |
| CHEBI:67818 | |
| 95% | |
| (-)-Caryophyllene oxide |
| 94.0 | |
| 55°C to 62°C | |
| 0.9600g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4956 | |
| 10 g | |
| 0.96 | |
| caryophyllene oxide, --caryophyllene oxide, beta-caryophyllene epoxide, beta-caryophyllene oxide, --epoxycaryophyllene, unii-s2xu9k448u, -carophyllene oxide, caryophyllene epoxide, epoxycaryophyllene, trans-caryophyllene oxide | |
| CC1(CC2C1CCC3(C(O3)CCC2=C)C)C | |
| 1742210 | |
| 220.35 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
EINECSNumber : 214-519-7
RUO – Research Use Only