Learn More
(-)-Caryophyllene oxide, 95%
CAS: 1139-30-6 | C15H24O | 220.35 g/mol
Supplier: Thermo Scientific Chemicals 325080100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| (-)-Caryophyllene oxide | |
| 94.0 | |
| 55°C to 62°C | |
| 0.9600g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4956 | |
| 10 g | |
| 0.96 | |
| caryophyllene oxide, --caryophyllene oxide, beta-caryophyllene epoxide, beta-caryophyllene oxide, --epoxycaryophyllene, unii-s2xu9k448u, -carophyllene oxide, caryophyllene epoxide, epoxycaryophyllene, trans-caryophyllene oxide | |
| CC1(CC2C1CCC3(C(O3)CCC2=C)C)C | |
| 1742210 | |
| 220.35 | |
| Crystalline Powder |
| 1139-30-6 | |
| 100.0 | |
| White | |
| >110°C | |
| 94% min. (GC) | |
| C15H24O | |
| MFCD00134216 | |
| 17, IV, 392 | |
| -55 | |
| NVEQFIOZRFFVFW-RGCMKSIDSA-N | |
| 220.35 | |
| CHEBI:67818 | |
| 95% |
Chemical Identifiers
| 1139-30-6 | |
| 220.35 | |
| NVEQFIOZRFFVFW-RGCMKSIDSA-N | |
| 1742210 | |
| CC1(CC2C1CCC3(C(O3)CCC2=C)C)C |
| C15H24O | |
| MFCD00134216 | |
| caryophyllene oxide, --caryophyllene oxide, beta-caryophyllene epoxide, beta-caryophyllene oxide, --epoxycaryophyllene, unii-s2xu9k448u, -carophyllene oxide, caryophyllene epoxide, epoxycaryophyllene, trans-caryophyllene oxide | |
| CHEBI:67818 |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
EINECSNumber : 214-519-7
RUO – Research Use Only