missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Carboxymethyl cellulose, sodium salt, average M.W. 90000 (DS=0.7)
CAS: 9004-32-4 | (C12 H14 O9 R6)n | 263.20 g/mol
$99.86 - $854.68
Chemical Identifiers
| CAS | 9004-32-4 |
|---|---|
| Molecular Formula | (C12 H14 O9 R6)n |
| Molecular Weight (g/mol) | 263.20 |
| MDL Number | MFCD00081472 |
| InChI Key | DPXJVFZANSGRMM-UHFFFAOYNA-N |
| Synonym | carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn |
| PubChem CID | 23706213 |
| SMILES | [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC332601000
|
Thermo Scientific Chemicals
332601000 |
100 g | Glass bottle |
Each for $99.86
|
|
||||
|
AC332600010
|
Thermo Scientific Chemicals
332600010 |
1 kg | Plastic bottle |
Each for $233.93
|
|
||||
|
AC332600050
|
Thermo Scientific Chemicals
332600050 |
5 kg | Plastic drum |
Each for $854.68
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 9004-32-4 | |
| 263.20 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| 23706213 |
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
Specifications
| White to Yellow | |
| Granular Powder | |
| >300.0°C | |
| MFCD00081472 | |
| 100 g | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O | |
| 263.20 | |
| ≥99.5% | |
| 10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
| 50-100 mPa.s 2% sol. |
| 6.5 to 8 (1% soln.) | |
| 9004-32-4 | |
| (C12 H14 O9 R6)n | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 | |
| Authentic | |
| Glass bottle | |
| Carboxymethylecellulose, sodium salt, Average M.W. 90000 (DS=0.7) |
RUO – Research Use Only