missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Carboxymethyl cellulose, sodium salt, average M.W. 250000 (DS=1.2)
CAS: 9004-32-4 | (C12 H14 O9 R6)n | 263.20 g/mol
Supplier: Thermo Scientific Chemicals 332631000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| White to Beige | |
| Average M.W. 250000 (DS=1.2) | |
| Crystalline Powder | |
| (C12 H14 O9 R6)n | |
| 15, 1830 | |
| 100 g | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O | |
| 263.20 | |
| ≥99.5% | |
| 10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
| 2300mPa·s, 2% sol. |
| Carboxymethylecellulose, sodium salt | |
| 6.5 to 8 (1% soln.) | |
| 9004-32-4 | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 | |
| Authentic | |
| Glass bottle |
Chemical Identifiers
| 9004-32-4 | |
| 263.20 | |
| DPXJVFZANSGRMM-UHFFFAOYNA-N | |
| 23706213 | |
| [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| (C12 H14 O9 R6)n | |
| MFCD00081472 | |
| carboxymethylcellulose sodium usp, celluvisc tn, carmellose sodium jp17, sodium dextrose acetate, c.m.c. tn | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
RUO – Research Use Only