missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calconcarboxylic Acid, Honeywell Fluka™
for complexometry
Supplier: Honeywell-Fluka 2126010G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Calconcarboxylic Acid | |
| For complexometry | |
| C21H14N2O7S | |
| NONH for all modes of transport | |
| ULIVOAKVRBXKKS-PYCFMQQDSA-N | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid | |
| 5895210 | |
| Plastic Bottle | |
| 10 g |
| 300°C | |
| 3737-95-9 | |
| MFCD00004078 | |
| 727492 | |
| C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O | |
| 438.41 | |
| 438.41g/mol | |
| Violet | |
| Powder |
Chemical Identifiers
| 3737-95-9 | |
| 438.41 | |
| ULIVOAKVRBXKKS-PYCFMQQDSA-N | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid |
| C21H14N2O7S | |
| MFCD00004078 | |
| 5895210 | |
| C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
Safety and Handling
EINECSNumber : 223-117-0