missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcium propionate hydrate, 97%
CAS: 4075-81-4 | C6H10CaO4 | 186.22 g/mol
$52.60 - $181.82
Chemical Identifiers
| CAS | 4075-81-4 |
|---|---|
| Molecular Formula | C6H10CaO4 |
| Molecular Weight (g/mol) | 186.22 |
| MDL Number | MFCD00167354 |
| InChI Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Synonym | calcium propionate, calcium dipropionate, calcium propanoate, mycoban, propanoic acid, calcium salt, bioban-c, caswell no. 151, propionic acid, calcium salt, unii-8ai80040kw, hsdb 907 |
| PubChem CID | 19999 |
| ChEBI | CHEBI:81716 |
| IUPAC Name | calcium;propanoate |
| SMILES | [Ca++].CCC([O-])=O.CCC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1499436
|
Thermo Scientific Chemicals
A1499436 |
500 g |
Each for $52.60
|
|
|||||
|
AAA149940E
|
Thermo Scientific Chemicals
A149940E |
2500 g |
Each for $181.82
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4075-81-4 | |
| 186.22 | |
| BCZXFFBUYPCTSJ-UHFFFAOYSA-L | |
| 19999 | |
| calcium;propanoate |
| C6H10CaO4 | |
| MFCD00167354 | |
| calcium propionate, calcium dipropionate, calcium propanoate, mycoban, propanoic acid, calcium salt, bioban-c, caswell no. 151, propionic acid, calcium salt, unii-8ai80040kw, hsdb 907 | |
| CHEBI:81716 | |
| [Ca++].CCC([O-])=O.CCC([O-])=O |
Specifications
| 4075-81-4 | |
| C6H10CaO4 | |
| 500 g | |
| 14,1698 | |
| BCZXFFBUYPCTSJ-UHFFFAOYSA-L | |
| calcium;propanoate | |
| 19999 | |
| 186.22 (Anhydrous) | |
| Calcium propionate hydrate |
| >300°C | |
| MFCD00167354 | |
| Hygroscopic | |
| calcium propionate, calcium dipropionate, calcium propanoate, mycoban, propanoic acid, calcium salt, bioban-c, caswell no. 151, propionic acid, calcium salt, unii-8ai80040kw, hsdb 907 | |
| [Ca++].CCC([O-])=O.CCC([O-])=O | |
| 186.22 | |
| CHEBI:81716 | |
| 97% |
Safety and Handling
H500
EINECSNumber : 223-795-8
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only