missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcium Phosphate, Monobasic, Monohydrate, Crystal, BAKER ANALYZED™ Reagent, J.T. Baker™
High quality chemicals for laboratory and specialized industrial use
$32130.78 - $36702.78
Chemical Identifiers
| CAS | 7758-23-8 |
|---|---|
| Molecular Formula | CaH4O8P2 |
| Molecular Weight (g/mol) | 234.05 |
| InChI Key | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| Synonym | calcium biphosphate, monobasic calcium phosphate, calcium dihydrogen phosphate, acid calcium phosphate, primary calcium phosphate, monocalcium orthophosphate, c 38 phosphate, calcium diorthophosphate, monocalcium phosphate, monobasic, calcium dihydrogen orthophosphate |
| PubChem CID | 24454 |
| ChEBI | CHEBI:35433 |
| IUPAC Name | calcium;dihydrogen phosphate |
| SMILES | OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
2002541
|
Avantor J.T.Baker
142601 |
500 g | Poly Bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
02002540
|
Avantor J.T.Baker
142605 |
2.5 kg | Poly Bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 7758-23-8 | |
| 234.05 | |
| calcium biphosphate, monobasic calcium phosphate, calcium dihydrogen phosphate, acid calcium phosphate, primary calcium phosphate, monocalcium orthophosphate, c 38 phosphate, calcium diorthophosphate, monocalcium phosphate, monobasic, calcium dihydrogen orthophosphate | |
| CHEBI:35433 | |
| OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] |
| CaH4O8P2 | |
| YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
| 24454 | |
| calcium;dihydrogen phosphate |
Specifications
| 7758-23-8 | |
| 500 g | |
| calcium biphosphate, monobasic calcium phosphate, calcium dihydrogen phosphate, acid calcium phosphate, primary calcium phosphate, monocalcium orthophosphate, c 38 phosphate, calcium diorthophosphate, monocalcium phosphate, monobasic, calcium dihydrogen orthophosphate | |
| OP(=O)(O)[O-].OP(=O)(O)[O-].[Ca+2] | |
| 234.05 | |
| CHEBI:35433 | |
| BAKER ANALYZED™ Reagent | |
| 1L = 2.22kg |
| Crystals | |
| CaH4O8P2 | |
| YYRMJZQKEFZXMX-UHFFFAOYSA-L | |
| calcium;dihydrogen phosphate | |
| 24454 | |
| 252.07 | |
| Poly Bottle | |
| Calcium Phosphate, Monobasic, Monohydrate |