missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcium Pantothenate, FCC, 97-103%, Spectrum™ Chemical
C1143, 137-08-6, C18H32CaN2O10
$415.31 - $3017.40
Chemical Identifiers
| CAS | 137-08-6 |
|---|---|
| Molecular Formula | C18H32CaN2O10 |
| Molecular Weight (g/mol) | 476.54 |
| MDL Number | MFCD00002766 |
| InChI Key | FAPWYRCQGJNNSJ-DXHDTSSINA-L |
| IUPAC Name | calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
| SMILES | [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
18601333
|
Spectrum Chemical Mfg Cor
C1143100GM |
100 g | Amber Glass Bottle |
Each for $415.31
|
|
||||
|
18601334
|
Spectrum Chemical Mfg Cor
C1143500GM |
500 g | Amber Glass Bottle |
Each for $1,198.11
|
|
||||
|
18601335
|
Spectrum Chemical Mfg Cor
C114325KG |
2.5 kg | Poly Pail |
Each for $3,017.40
|
|
||||
Description
Spectrum™ Chemical Calcium Pantothenate, FCC is often used in dietary supplements because, as a salt, it is more stable than pantothenic acid (Vitamin B5). The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food Grade (FCC) chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 137-08-6 | |
| 476.54 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| C18H32CaN2O10 | |
| MFCD00002766 | |
| calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) |
Specifications
| 137-08-6 | |
| 5% | |
| Amber Glass Bottle | |
| +25.0° to +27.5° | |
| [Ca++].CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O.CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O | |
| 100 g | |
| 97 to 103% |
| 100% | |
| C18H32CaN2O10 | |
| MFCD00002766 | |
| FAPWYRCQGJNNSJ-DXHDTSSINA-L | |
| calcium bis(3-[(2R)-2,4-dihydroxy-3,3-dimethylbutanamido]propanoate) | |
| 476.54 | |
| FCC |