missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcium acetate hydrate, 99%, extra pure
CAS: 114460-21-8 | C4H6CaO4 | 158.17 g/mol
$158.71 - $368.56
Chemical Identifiers
| CAS | 114460-21-8 |
|---|---|
| Molecular Formula | C4H6CaO4 |
| Molecular Weight (g/mol) | 158.17 |
| MDL Number | MFCD00012448 |
| InChI Key | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| Synonym | Acetic acid, calcium salt hydrate |
| IUPAC Name | calcium diacetate |
| SMILES | [Ca++].CC([O-])=O.CC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC211052500
|
Thermo Scientific Chemicals
211052500 |
250 g | Plastic bottle |
Each for $158.71
|
|
||||
|
AC211050010
|
Thermo Scientific Chemicals
211050010 |
1 kg | Plastic bottle |
Each for $368.56
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 114460-21-8 | |
| 158.17 | |
| VSGNNIFQASZAOI-UHFFFAOYSA-L | |
| calcium diacetate |
| C4H6CaO4 | |
| MFCD00012448 | |
| Acetic acid, calcium salt hydrate | |
| [Ca++].CC([O-])=O.CC([O-])=O |
Specifications
| White | |
| 7.0 to 9.0 (10% soln., 20°C) | |
| 250 g | |
| C4H6CaO4 | |
| MFCD00012448 | |
| 13,60; 15,46 | |
| Acetic acid, calcium salt hydrate | |
| VSGNNIFQASZAOI-UHFFFAOYSA-L | |
| calcium diacetate | |
| 158.17 | |
| Extra Pure | |
| Plastic bottle |
| 114460-21-8 | |
| Powder and/or Agglomerates | |
| 98.5 to 101.5% (on anhydrous substance) (Complexometry) | |
| (CH3CO2)2Ca | |
| 02,IV,113 | |
| 14,1646 | |
| Solubility in water: 250g/L (20°C). Other solubilities: slightly soluble in alcohol | |
| [Ca++].CC([O-])=O.CC([O-])=O | |
| 158.17 | |
| 99% | |
| Authentic | |
| Calcium acetate hydrate |
RUO – Research Use Only