missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Calcein (mixture of isomers) [for Fluorometric Determination of Ca], TCI America™
Supplier: TCI America C00041G
Specifications
| Calcein (mixture of isomers) [for Fluorometric Determination of Ca] | |
| C30H26N2O13 | |
| Fluorexon, Fluorescein Bis(methyliminodiacetic Acid), Bis[N,N-bis(carboxymethyl)aminomethyl]fluorescein | |
| OC(=O)CN(CC(O)=O)CC1=C(O)C=C2OC3=CC(O)=C(CN(CC(O)=O)CC(O)=O)C=C3C3(OC(=O)C4=CC=CC=C34)C2=C1 | |
| 622.54 | |
| CHEBI:51903 | |
| 1 g |
| 154071-48-4 | |
| MFCD00005049,MFCD09750388 | |
| DEGAKNSWVGKMLS-UHFFFAOYSA-N | |
| 2-{[(7'-{[bis(carboxymethyl)amino]methyl}-3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-2'-yl)methyl](carboxymethyl)amino}acetic acid | |
| 65079 | |
| 622.54 | |
| Crystal/Powder |
Chemical Identifiers
| 154071-48-4 | |
| 622.54 | |
| DEGAKNSWVGKMLS-UHFFFAOYSA-N | |
| 65079 | |
| 2-{[(7'-{[bis(carboxymethyl)amino]methyl}-3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-2'-yl)methyl](carboxymethyl)amino}acetic acid |
| C30H26N2O13 | |
| MFCD00005049,MFCD09750388 | |
| Fluorexon, Fluorescein Bis(methyliminodiacetic Acid), Bis[N,N-bis(carboxymethyl)aminomethyl]fluorescein | |
| CHEBI:51903 | |
| OC(=O)CN(CC(O)=O)CC1=C(O)C=C2OC3=CC(O)=C(CN(CC(O)=O)CC(O)=O)C=C3C3(OC(=O)C4=CC=CC=C34)C2=C1 |
Safety and Handling
TSCA : Yes