missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Caffeine Anhydrous MP Biomedicals
$76.94 - $76.94
Chemical Identifiers
| CAS | 58-08-2 |
|---|---|
| Molecular Formula | C8H10N4O2 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00005758 |
| InChI Key | RYYVLZVUVIJVGH-UHFFFAOYSA-N |
| Synonym | caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep |
| PubChem CID | 2519 |
| ChEBI | CHEBI:27732 |
| IUPAC Name | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| SMILES | CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN15011480
|
MP Biomedicals Inc
0215011480 |
100 g |
Each for $76.94
|
|
|||||
Chemical Identifiers
| 58-08-2 | |
| 194.19 | |
| RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
| 2519 | |
| 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| C8H10N4O2 | |
| MFCD00005758 | |
| caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep | |
| CHEBI:27732 | |
| CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
Specifications
| 58-08-2 | |
| 1.23g/mL | |
| MFCD00005758 | |
| caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep | |
| CN1C=NC2=C1C(=O)N(C)C(=O)N2C | |
| 194.19 | |
| CHEBI:27732 | |
| Powder |
| White | |
| C8H10N4O2 | |
| 100 g | |
| RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
| 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
| 2519 | |
| 194.2 | |
| Caffeine Anhydrous, Anhydrous |
Safety and Handling
Recommended Storage : Store at room temperature (15° to 30°C).