missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Caffeine Anhydrous MP Biomedicals
Supplier: MP Biomedicals Inc 0215011480
Specifications
| Caffeine Anhydrous | |
| 58-08-2 | |
| 1.23g/mL | |
| MFCD00005758 | |
| caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep | |
| CN1C=NC2=C1C(=O)N(C)C(=O)N2C | |
| 194.19 | |
| CHEBI:27732 | |
| Powder |
| Anhydrous | |
| White | |
| C8H10N4O2 | |
| 100 g | |
| RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
| 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
| 2519 | |
| 194.2 |
Chemical Identifiers
| 58-08-2 | |
| 194.19 | |
| RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
| 2519 | |
| 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| C8H10N4O2 | |
| MFCD00005758 | |
| caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep | |
| CHEBI:27732 | |
| CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
Safety and Handling
Recommended Storage : Store at room temperature (15° to 30°C).