missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Cabazitaxel, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468891000
Specifications
| Cabazitaxel | |
| Available | |
| Powder | |
| MFCD18827611 | |
| 170°C to 180°C | |
| COC1CC2OCC2(OC(C)=O)C2C(OC(=O)C3=CC=CC=C3)C3(O)CC(OC(=O)C(O)C(NC(=O)OC(C)(C)C)C4=CC=CC=C4)C(C)=C(C(OC)C(=O)C12C)C3(C)C | |
| 835.94 |
| Glass Bottle | |
| 183133-96-2 | |
| C45H57NO14 | |
| White to Yellow to Beige | |
| BMQGVNUXMIRLCK-UHFFFAOYNA-N | |
| 4-(acetyloxy)-15-[(3-{[(tert-butoxy)carbonyl]amino}-2-hydroxy-3-phenylpropanoyl)oxy]-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹â°.0â´,â·]heptadec-13-en-2-yl benzoate | |
| 100 mg |
Chemical Identifiers
| 183133-96-2 | |
| 835.94 | |
| BMQGVNUXMIRLCK-UHFFFAOYNA-N | |
| COC1CC2OCC2(OC(C)=O)C2C(OC(=O)C3=CC=CC=C3)C3(O)CC(OC(=O)C(O)C(NC(=O)OC(C)(C)C)C4=CC=CC=C4)C(C)=C(C(OC)C(=O)C12C)C3(C)C |
| C45H57NO14 | |
| MFCD18827611 | |
| 4-(acetyloxy)-15-[(3-{[(tert-butoxy)carbonyl]amino}-2-hydroxy-3-phenylpropanoyl)oxy]-1-hydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.0³,¹â°.0â´,â·]heptadec-13-en-2-yl benzoate |
Safety and Handling
Health hazard
Exclamation mark
Recommended Storage : Normal conditions