missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Butoconazole nitrate, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468770010
Specifications
| Butoconazole nitrate | |
| Available | |
| Crystalline Powder | |
| 00058159 | |
| 163°C | |
| ZHPWRQIPPNZNML-UHFFFAOYNA-N | |
| 1-[4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl]-1H-imidazole; nitric acid | |
| 1 g |
| Glass Bottle | |
| 64872-77-1 | |
| C19H18Cl3N3O3S | |
| White to Light Yellow | |
| 13-1525 | |
| O[N+]([O-])=O.ClC1=CC=C(CCC(CN2C=CN=C2)SC2=C(Cl)C=CC=C2Cl)C=C1 | |
| 474.78 |
Chemical Identifiers
| 64872-77-1 | |
| 474.78 | |
| ZHPWRQIPPNZNML-UHFFFAOYNA-N | |
| O[N+]([O-])=O.ClC1=CC=C(CCC(CN2C=CN=C2)SC2=C(Cl)C=CC=C2Cl)C=C1 |
| C19H18Cl3N3O3S | |
| 00058159 | |
| 1-[4-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)sulfanyl]butyl]-1H-imidazole; nitric acid |
Safety and Handling
Exclamation mark
RTECSNumber : NI4399500
Recommended Storage : Normal conditions