missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromothymol Blue, Reagent, ACS, Spectrum™ Chemical
BR154, 76-59-5, 34722-90-2, C27H28O5SBr2
Supplier: Spectrum Chemical Mfg Cor BR1541KGBL
Description
Spectrum™ Chemical Bromothymol Blue, Reagent, ACS is a pH indicator for weak acids and bases. It is mostly used in applications that require measuring substances that would have a relatively neutral pH (near 7), such as managing the pH of pools and fish tanks. As an ACS grade quality reagent, its chemical specifications are the de facto standards for chemicals used in many high-purity applications and typically designate the highest quality chemical available for laboratory use. Spectrum Chemical manufactured Reagent ACS grade products meet the toughest regulatory standards for quality and purity.Specifications
| Bromothymol Blue | |
| 100% | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-3H-2,1λâ¶-benzoxathiole-1,1-dione | |
| ACS | |
| Purple/Violet | |
| 1 kg |
| 76-59-5 | |
| C27H28Br2O5S | |
| CC(C)C1=CC(=C(C)C(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C(Br)=C1C | |
| 624.38 | |
| Amber Glass Bottle | |
| 6.0 to 7.6 |
Chemical Identifiers
| 76-59-5 | |
| 624.38 | |
| 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-3H-2,1λâ¶-benzoxathiole-1,1-dione |
| C27H28Br2O5S | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| CC(C)C1=CC(=C(C)C(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C(Br)=C1C |