missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromophenol Blue Sodium Salt, ACS Grade, LabChem™
Supplier: LabChem LC120107
Specifications
| Bromophenol Blue Sodium Salt | |
| 100 | |
| C19H9Br4O5S·Na | |
| Passes Test | |
| C1=CC=C(C(=C1)C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br)S(=O)(=O)[O-].[Na+] | |
| 691.942 | |
| 691.95 | |
| Amber Glass | |
| 10 g |
| 62625-28-9 | |
| C19H9Br4NaO5S | |
| Soluble in water | |
| TWKDJMRHSLWRFI-UHFFFAOYSA-M | |
| sodium;2-[(3,5-dibromo-4-hydroxyphenyl)-(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate | |
| 3791690 | |
| ACS | |
| Sulfur compounds; Carbon monoxide; Carbon dioxide; Hydrogen bromide | |
| Powder |
Chemical Identifiers
| 62625-28-9 | |
| 691.942 | |
| 3791690 | |
| C1=CC=C(C(=C1)C(=C2C=C(C(=O)C(=C2)Br)Br)C3=CC(=C(C(=C3)Br)O)Br)S(=O)(=O)[O-].[Na+] |
| C19H9Br4NaO5S | |
| TWKDJMRHSLWRFI-UHFFFAOYSA-M | |
| sodium;2-[(3,5-dibromo-4-hydroxyphenyl)-(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
Safety and Handling
GHS H Statement
Product is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature