missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromophenol Blue, Indicator, Reag. Ph. Eur., Honeywell Fluka™
Indicator, Reag. Ph. Eur.
$141.50 - $400.56
Chemical Identifiers
| CAS | 115-39-9 |
|---|---|
| Molecular Formula | C19H10Br4O5S |
| Molecular Weight (g/mol) | 669.96 |
| MDL Number | MFCD00005875 |
| InChI Key | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Synonym | 3′,3′′,5′,5′′-Tetrabromophenolsulfonephthalein, Bromophenol Blue (BPB), Bromphenol Blue Sultone Form |
| PubChem CID | 8272 |
| ChEBI | CHEBI:59424 |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 3′,3′′,5′,5′′-Tetrabromophenolsulfonephthalein, Bromophenol Blue (BPB), Bromphenol Blue Sultone Form | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Specifications
| 204°C | |
| C19H10Br4O5S | |
| NONH for all modes of transport | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96g/mol | |
| Red | |
| 5 g | |
| Bromophenol Blue, Reag. Ph. Eur. |
| 115-39-9 | |
| MFCD00005875 | |
| 61698 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| Glass Bottle | |
| 2.8 to 4.4 | |
| Powder |
Safety and Handling
ShelfLife : 1620 days from date of manufacture
Recommended Storage : Room Temp