missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromophenol Blue, Indicator, Reag. Ph. Eur., Honeywell Fluka™
Indicator, Reag. Ph. Eur.
Supplier: Honeywell Chemicals 327125G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Bromophenol Blue | |
| Reag. Ph. Eur. | |
| C19H10Br4O5S | |
| NONH for all modes of transport | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96g/mol | |
| Red | |
| 5 g |
| 204°C | |
| 115-39-9 | |
| MFCD00005875 | |
| 61698 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| Glass Bottle | |
| 2.8 to 4.4 | |
| Powder |
Chemical Identifiers
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
Safety and Handling
EINECSNumber : 204-086-2
RTECSNumber : SJ7453000