missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bromophenol Blue, pure, indicator
Bromophenol Blue, C19H10Br4O5S, CAS Number-115-39-9, 3', 3″, 5', 3',3″,5',5″-Tetrabromophenolsulfonephthalein, BPB, 25g, 19, I, 649, CHEBI:59424, Orange-Pink to Red, 669.96, Pure, UDSAIICHUKSCKT-UHFFFAOYSA-N, Authentic | CAS: 115-39-9 | C19H10Br4O5S | 669.96 g/mol
$187.80 - $624.49
Chemical Identifiers
| CAS | 115-39-9 |
|---|---|
| Molecular Formula | C19H10Br4O5S |
| Molecular Weight (g/mol) | 669.96 |
| MDL Number | MFCD00005875 |
| InChI Key | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Synonym | 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' |
| PubChem CID | 8272 |
| ChEBI | CHEBI:59424 |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC151340250
|
Thermo Scientific Chemicals
151340250 |
25 g | Glass bottle |
Each for $187.80
|
|
||||
|
AC151341000
|
Thermo Scientific Chemicals
151341000 |
100 g | Glass bottle |
Each for $624.49
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Specifications
| 279.0°C | |
| C19H10Br4O5S | |
| 19, I, 649 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| Pure | |
| 1100 min. (592nm, in buffer) | |
| Orange/Pink to Red | |
| Powder |
| 115-39-9 | |
| MFCD00005875 | |
| 15, 1454 | |
| Solubility in water: 0.4g/100mL | |
| Authentic | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96 | |
| Glass bottle | |
| from pH 3.0 (yellow) to pH 4.6 (blue) | |
| 25 g | |
| Bromophenol Blue, Indicator |
RUO – Research Use Only