missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Brimonidine tartrate, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468842500
Specifications
| Brimonidine tartrate | |
| Available | |
| Powder | |
| 07773072 | |
| 207°C | |
| QZHBYNSSDLTCRG-LREBCSMRSA-N | |
| (2R,3R)-2,3-dihydroxybutanedioic acid; 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine | |
| 250 mg |
| Glass Bottle | |
| 70359-46-5 | |
| C15H16BrN5O6 | |
| White to Light Yellow to Light Brown | |
| Soluble in water | |
| O[C@H]([C@@H](O)C(O)=O)C(O)=O.BrC1=C2N=CC=NC2=CC=C1NC1=NCCN1 | |
| 442.23 |
Chemical Identifiers
| 70359-46-5 | |
| 442.23 | |
| QZHBYNSSDLTCRG-LREBCSMRSA-N | |
| O[C@H]([C@@H](O)C(O)=O)C(O)=O.BrC1=C2N=CC=NC2=CC=C1NC1=NCCN1 |
| C15H16BrN5O6 | |
| 07773072 | |
| (2R,3R)-2,3-dihydroxybutanedioic acid; 5-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)quinoxalin-6-amine |
Safety and Handling
Skull and crossbones
Recommended Storage : Normal conditions