missing translation for 'onlineSavingsMsg'
Learn More
Learn More
BOC-D-Alanine, 99+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 275720050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| BOC-D-Alanine | |
| Authentic | |
| C8H15NO4 | |
| (CH3)3COC(O)nHC(CH3)COOH | |
| +25° to +27° (20°C, 589nm) (c=2, CH3COOH) | |
| boc-d-alanine, boc-d-ala-oh, n-boc-d-alanine, n-tert-butoxycarbonyl-d-alanine, r-2-tert-butoxycarbonyl amino propanoic acid, n-alpha-t-boc-d-alanine, boc-d-ala, n-t-butoxycarbonyl-d-alanine, 2r-2-tert-butoxy carbonyl amino propanoic acid | |
| CC(C(=O)O)NC(=O)OC(C)(C)C | |
| 5g | |
| 637606 | |
| ≥99.0% |
| 7764-95-6 | |
| 99+% | |
| Glass bottle | |
| MFCD00063123 | |
| 04, 2507 | |
| QVHJQCGUWFKTSE-RXMQYKEDSA-N | |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid | |
| 189.211 | |
| 189.21 |
Chemical Identifiers
| 7764-95-6 | |
| 189.211 | |
| QVHJQCGUWFKTSE-RXMQYKEDSA-N | |
| 637606 | |
| CC(C(=O)O)NC(=O)OC(C)(C)C |
| C8H15NO4 | |
| MFCD00063123 | |
| boc-d-alanine, boc-d-ala-oh, n-boc-d-alanine, n-tert-butoxycarbonyl-d-alanine, r-2-tert-butoxycarbonyl amino propanoic acid, n-alpha-t-boc-d-alanine, boc-d-ala, n-t-butoxycarbonyl-d-alanine, 2r-2-tert-butoxy carbonyl amino propanoic acid | |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
RUO â Research Use Only