missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(trimethylsilyl)telluride, 98%
CAS: 4551-16-0 | C6H18Si2Te | 273.97 g/mol
Supplier: Thermo Scientific Chemicals 291660050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bis(trimethylsilyl)telluride | |
| 4551-16-0 | |
| Brown-Orange | |
| 74°C (11.0 mmHg) | |
| 98% | |
| C6H18Si2Te | |
| MFCD00143782 | |
| 0.97 | |
| Solubility in water: .. Other solubilities: soluble in toluene,thf,hydrocarbons | |
| C[Si](C)(C)[Te][Si](C)(C)C | |
| 273.97 | |
| 273.97 | |
| Liquid |
| 98% | |
| 13.5°C | |
| 0.9700g/mL | |
| Authentic | |
| Glass bottle | |
| (Si(CH3)3)2Te | |
| 5 mL | |
| bis-trimethylsilyl telluride, bis trimethylsilyl telluride, disilatellurane, hexamethyl, bis trimethylsilyl-telluride, trimethyl trimethylsilyltellanyl silane, et 2s,3s-2,3-epoxy-3-metpro, 1,1,1,3,3,3-hexamethyldisilatellurane #, disilatellurane,1,1,1,3,3,3-hexamethyl | |
| VMDCDZDSJKQVBK-UHFFFAOYSA-N | |
| trimethyl(trimethylsilyltellanyl)silane | |
| 553023 | |
| 98% |
Chemical Identifiers
| 4551-16-0 | |
| 273.97 | |
| VMDCDZDSJKQVBK-UHFFFAOYSA-N | |
| 553023 | |
| C[Si](C)(C)[Te][Si](C)(C)C |
| C6H18Si2Te | |
| MFCD00143782 | |
| bis-trimethylsilyl telluride, bis trimethylsilyl telluride, disilatellurane, hexamethyl, bis trimethylsilyl-telluride, trimethyl trimethylsilyltellanyl silane, et 2s,3s-2,3-epoxy-3-metpro, 1,1,1,3,3,3-hexamethyldisilatellurane #, disilatellurane,1,1,1,3,3,3-hexamethyl | |
| trimethyl(trimethylsilyltellanyl)silane |
Safety and Handling
MOISTURE SENSITIVE
GHS Signal Word: Danger
RUO – Research Use Only