missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(phenylsulfonyl)sulfide, 96%
CAS: 4388-22-1 | C12H10O4S3 | 314.39 g/mol
Supplier: Thermo Scientific Chemicals 300830050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bis(phenylsulfonyl)sulfide | |
| 129.0°C to 134.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00094733 | |
| 11,III,163 | |
| YQUSJUJNDKUWAM-UHFFFAOYSA-N | |
| benzenesulfonylsulfanylsulfonylbenzene | |
| 257516 | |
| 96% |
| 4388-22-1 | |
| Pink to White | |
| 95% min. (HPLC) | |
| C12H10O4S3 | |
| 5 g | |
| bis phenylsulfonyl sulfide, benzenesulfonyl sulfide, benzenesulfonic thioanhydride, benzenesulfonothioic acid, anhydrosulfide, benzenesulfonic acid, thio-, anhydrosulfide, bis phenylsulfonyl thio, benzenesulfonyl sulfanylsulfonyl benzene, phso2 2s, benzenesulfonylthio sulfonylbenzene | |
| O=S(=O)(SS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 314.39 | |
| 314.41 | |
| Crystals or Powder |
Chemical Identifiers
| 4388-22-1 | |
| 314.39 | |
| YQUSJUJNDKUWAM-UHFFFAOYSA-N | |
| 257516 | |
| O=S(=O)(SS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| C12H10O4S3 | |
| MFCD00094733 | |
| bis phenylsulfonyl sulfide, benzenesulfonyl sulfide, benzenesulfonic thioanhydride, benzenesulfonothioic acid, anhydrosulfide, benzenesulfonic acid, thio-, anhydrosulfide, bis phenylsulfonyl thio, benzenesulfonyl sulfanylsulfonyl benzene, phso2 2s, benzenesulfonylthio sulfonylbenzene | |
| benzenesulfonylsulfanylsulfonylbenzene |
RUO – Research Use Only