Learn More
Bis(neopentyl glycolato)diboron, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 358890010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Bis(neopentyl glycolato)diboron | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| MFCD02093062 | |
| bis neopentyl glycolato diboron, bis neopentylglycolato diboron, 5,5,5',5'-tetramethyl-2,2'-bi 1,3,2-dioxaborinane, 2-5,5-dimethyl-1,3,2-dioxaborinan-2-yl-5,5-dimethyl-1,3,2-dioxaborinane, 5,5,5',5'-tetramethyl-2,2'-bi-1,3,2-dioxaborinane, 2,2'-bi-1,3,2-dioxaborinane, 5,5,5',5'-tetramethyl, bis neopentyl glycolato diborane, bis 2,2-dimethyl-1,3-propanediolato diboron, 5,5,5',5'-tetramethyl-2,2' bi 1,3,2 dioxaborinanyl | |
| B1(OCC(CO1)(C)C)B2OCC(CO2)(C)C | |
| 225.88 | |
| 225.88 |
| 201733-56-4 | |
| 100.0 | |
| 97.5% min. (GC) | |
| C10H20B2O4 | |
| 1g | |
| MDNDJMCSXOXBFZ-UHFFFAOYSA-N | |
| 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5,5-dimethyl-1,3,2-dioxaborinane | |
| 2734316 | |
| 98% |
Chemical Identifiers
| 201733-56-4 | |
| 225.88 | |
| MDNDJMCSXOXBFZ-UHFFFAOYSA-N | |
| 2734316 | |
| B1(OCC(CO1)(C)C)B2OCC(CO2)(C)C |
| C10H20B2O4 | |
| MFCD02093062 | |
| bis neopentyl glycolato diboron, bis neopentylglycolato diboron, 5,5,5',5'-tetramethyl-2,2'-bi 1,3,2-dioxaborinane, 2-5,5-dimethyl-1,3,2-dioxaborinan-2-yl-5,5-dimethyl-1,3,2-dioxaborinane, 5,5,5',5'-tetramethyl-2,2'-bi-1,3,2-dioxaborinane, 2,2'-bi-1,3,2-dioxaborinane, 5,5,5',5'-tetramethyl, bis neopentyl glycolato diborane, bis 2,2-dimethyl-1,3-propanediolato diboron, 5,5,5',5'-tetramethyl-2,2' bi 1,3,2 dioxaborinanyl | |
| 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5,5-dimethyl-1,3,2-dioxaborinane |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
RUO â Research Use Only