missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2-ethylhexyl) terephthalate, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 402490100
| Quantity | 10kg |
|---|
Description
Chemical Identifiers
| 6422-86-2 | |
| 390.55 | |
| bis 2-ethylhexyl terephthalate, kodaflex dotp, di-2-ethylhexyl terephthalate, 1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester, terephthalic acid, bis 2-ethylhexyl ester, eastman 168, ccris 7052, di 2-ethylhexyl terephthalate, bis 2-ethylhexyl benzene-1,4-dicarboxylate, 1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester | |
| bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| C24H38O4 | |
| RWPICVVBGZBXNA-UHFFFAOYSA-N | |
| 22932 | |
| CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
Specifications
| Bis(2-ethylhexyl) terephthalate | |
| 0.9840g/mL | |
| >110°C | |
| 96% min. (GC) | |
| 1.4890 to 1.4910 | |
| 09,IV,3306 | |
| bis 2-ethylhexyl terephthalate, kodaflex dotp, di-2-ethylhexyl terephthalate, 1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester, terephthalic acid, bis 2-ethylhexyl ester, eastman 168, ccris 7052, di 2-ethylhexyl terephthalate, bis 2-ethylhexyl benzene-1,4-dicarboxylate, 1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester | |
| RWPICVVBGZBXNA-UHFFFAOYSA-N | |
| bis(2-ethylhexyl) benzene-1,4-dicarboxylate | |
| 22932 | |
| 97% |
| 6422-86-2 | |
| 400.0°C | |
| Authentic | |
| C24H38O4 | |
| 10kg | |
| 0.984 | |
| Solubility in water: insoluble. | |
| CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC | |
| 390.55 | |
| 390.55 |
Safety and Handling
EINECSNumber : 229-176-9