missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2-ethylhexyl) hydrogen phosphate, 95%
CAS: 298-07-7 | C16H35O4P | 322.43 g/mol
Supplier: Thermo Scientific Chemicals 402470010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bis(2-ethylhexyl) hydrogen phosphate | |
| 94.0 | |
| -60.0°C | |
| 0.9700g/mL | |
| 137°C | |
| 95% | |
| C16H35O4P | |
| (CH3(CH2)3CH(C2H5)CH2O)2POOH | |
| 1 kg | |
| 0.97 | |
| Solubility in water: slightly soluble | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC | |
| 322.43 | |
| 322.42 | |
| Liquid |
| 298-07-7 | |
| 100.0 | |
| Colorless to Yellow | |
| 48.0°C (12.0 mmHg) | |
| Authentic | |
| Glass Bottle | |
| 1.4400 to 1.4440 | |
| MFCD00009492 | |
| 01,IV,1786 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| bis(2-ethylhexyl) hydrogen phosphate | |
| 9275 | |
| 95% |
Chemical Identifiers
| 298-07-7 | |
| 322.43 | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| 9275 | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| C16H35O4P | |
| MFCD00009492 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| bis(2-ethylhexyl) hydrogen phosphate |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 206-056-4
RUO – Research Use Only