missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2-ethylhexyl) hydrogen phosphate, 95%
CAS: 298-07-7 | C16H35O4P | 322.43 g/mol
$511.39 - $511.39
Chemical Identifiers
| CAS | 298-07-7 |
|---|---|
| Molecular Formula | C16H35O4P |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Synonym | bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid |
| PubChem CID | 9275 |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC402470010
|
Thermo Scientific Chemicals
402470010 |
1 kg | Glass Bottle |
Each for $511.39
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 298-07-7 | |
| 322.43 | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| 9275 | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| C16H35O4P | |
| MFCD00009492 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| bis(2-ethylhexyl) hydrogen phosphate |
Specifications
| 298-07-7 | |
| 100.0 | |
| Colorless to Yellow | |
| 48.0°C (12.0 mmHg) | |
| Authentic | |
| Glass Bottle | |
| 1.4400 to 1.4440 | |
| MFCD00009492 | |
| 01,IV,1786 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| SEGLCEQVOFDUPX-UHFFFAOYNA-N | |
| bis(2-ethylhexyl) hydrogen phosphate | |
| 9275 | |
| 95% | |
| Bis(2-ethylhexyl) hydrogen phosphate |
| 94.0 | |
| -60.0°C | |
| 0.9700g/mL | |
| 137°C | |
| 95% | |
| C16H35O4P | |
| (CH3(CH2)3CH(C2H5)CH2O)2POOH | |
| 1 kg | |
| 0.97 | |
| Solubility in water: slightly soluble | |
| CCCCC(CC)COP(O)(=O)OCC(CC)CCCC | |
| 322.43 | |
| 322.42 | |
| Liquid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 206-056-4
RUO – Research Use Only