missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Beta - Nicotinamide Adenine Dinucleotide Phosphate Reduced Tetrasodium Salt 98% MP Biomedicals
Supplier: MP Biomedicals Inc 0210116780
Specifications
| Beta - Nicotinamide Adenine Dinucleotide Phosphate | |
| 2646-71-1 | |
| C21H26N7Na4O17P3 | |
| 100 mg | |
| WYWWVJHQDVCHKF-NRTBITFTNA-J | |
| [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium | |
| 131673986 | |
| 98% |
| Reduced Tetrasodium Salt | |
| 98% | |
| MFCD10567216 | |
| nadph tetrasodium salt, nadph, tetrasodium salt, coenzyme ii tetrasodium salt reduced form | |
| NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](OP(O)(O)=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O | |
| 833.35 | |
| 833.4 | |
| Powder |
Chemical Identifiers
| 2646-71-1 | |
| 833.35 | |
| WYWWVJHQDVCHKF-NRTBITFTNA-J | |
| 131673986 |
| C21H26N7Na4O17P3 | |
| MFCD10567216 | |
| nadph tetrasodium salt, nadph, tetrasodium salt, coenzyme ii tetrasodium salt reduced form |