missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzyltriphenylphosphonium Chloride, 99%
CAS: 1100-88-5 | C25H22ClP | 388.87 g/mol
$63.39 - $156.50
Chemical Identifiers
| CAS | 1100-88-5 |
|---|---|
| Molecular Formula | C25H22ClP |
| Molecular Weight (g/mol) | 388.87 |
| MDL Number | MFCD00011913 |
| InChI Key | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| Synonym | benzyltriphenylphosphonium chloride, triphenylbenzylphosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride, benzyltriphenylphosphanium chloride, benzyl triphenylphosphonium chloride, benzyl-triphenyl-phosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride 1:1, triphenylbenzylphosphine, chloride, benzyl triphenyl phosphoniumchlorid |
| PubChem CID | 70671 |
| IUPAC Name | benzyl(triphenyl)phosphanium;chloride |
| SMILES | [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC106210250
|
Thermo Scientific Chemicals
106210250 |
25 g | Glass bottle |
Each for $63.39
|
|
||||
|
AC106211000
|
Thermo Scientific Chemicals
106211000 |
100 g | Glass bottle |
Each for $156.50
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
For C-C Bond Formation (Olefination)Chemical Identifiers
| 1100-88-5 | |
| 388.87 | |
| USFRYJRPHFMVBZ-UHFFFAOYSA-M | |
| 70671 | |
| [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C25H22ClP | |
| MFCD00011913 | |
| benzyltriphenylphosphonium chloride, triphenylbenzylphosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride, benzyltriphenylphosphanium chloride, benzyl triphenylphosphonium chloride, benzyl-triphenyl-phosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride 1:1, triphenylbenzylphosphine, chloride, benzyl triphenyl phosphoniumchlorid | |
| benzyl(triphenyl)phosphanium;chloride |
Specifications
| 1100-88-5 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| C6H5CH2P(C6H5)3Cl | |
| 25 g | |
| Solubility in water: soluble. Other solubilities: soluble in chloroform,slightly soluble in lower aliphatic alcohols | |
| [Cl-].C(C1=CC=CC=C1)[P+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 388.87 | |
| 388.86 | |
| Crystalline Powder |
| 98.5 | |
| 337.0°C | |
| >300°C | |
| 98.5% min. (Argentometry) | |
| C25H22ClP | |
| MFCD00011913 | |
| benzyltriphenylphosphonium chloride, triphenylbenzylphosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride, benzyltriphenylphosphanium chloride, benzyl triphenylphosphonium chloride, benzyl-triphenyl-phosphonium chloride, phosphonium, triphenyl phenylmethyl-, chloride 1:1, triphenylbenzylphosphine, chloride, benzyl triphenyl phosphoniumchlorid | |
| USFRYJRPHFMVBZ-UHFFFAOYSA-M | |
| benzyl(triphenyl)phosphanium;chloride | |
| 70671 | |
| 99% | |
| Benzyltriphenylphosphonium chloride |
Safety and Handling
GHS H Statement
Fatal if swallowed.
Fatal if inhaled.
Causes skin irritation.
Causes serious eye damage.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with wat
GHS Signal Word: Danger
EINECSNumber : 214-154-3
RUO – Research Use Only