Learn More
Benzyltrimethylammonium chloride, 98+%
CAS: 56-93-9 | C10H16ClN | 185.70 g/mol
Supplier: Thermo Scientific Chemicals 211862500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Phase transfer catalystSpecifications
| Benzyltrimethylammonium chloride | |
| 56-93-9 | |
| 100.0 | |
| White to Ivory | |
| 98+% | |
| C10H16ClN | |
| MFCD00011782 | |
| 12, 1020 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| benzyl(trimethyl)azanium;chloride | |
| 5963 | |
| 185.7 | |
| Crystalline Powder and/or Chunks |
| 98+% | |
| 98.0 | |
| 239.0°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2N(CH3)3Cl | |
| 250 g | |
| 01,53 | |
| Solubility in water: 800g/L. Other solubilities: soluble in ethanol and butanol,slightly soluble in butyl phthalate and,tributyl phosphate | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 | |
| 185.70 | |
| 10 mPa.s (20°C) | |
| 98+% |
Chemical Identifiers
| 56-93-9 | |
| 185.70 | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| 5963 | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| C10H16ClN | |
| MFCD00011782 | |
| benzyltrimethylammonium chloride, tmbac, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyl trimethyl ammonium chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyltrimethylazanium chloride, unii-vnk45y7ba1, ammonium, benzyltrimethyl-, chloride, trimethylbenzylammonium chloride | |
| benzyl(trimethyl)azanium;chloride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Toxic in contact with skin.
Harmful if inhaled.
Suspected of causing genetic defects.
Harmful to aquatic life with long lasting effects.
Toxic by eye contact.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse
GHS Signal Word: Danger
EINECSNumber : 200-300-3
RTECSNumber : BO8400000
TSCA : TSCA
RUO – Research Use Only