missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzopinacole, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 105591000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Benzopinacole | |
| 464-72-2 | |
| 100.0 | |
| 97.5% min. (HPLC) | |
| C26H22O2 | |
| MFCD00004448 | |
| 06, 1058 | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 1,1,2,2-tetraphenylethane-1,2-diol | |
| 94766 | |
| 98% |
| 98% | |
| 97.5 | |
| Authentic | |
| Plastic bottle | |
| (C6H5)2C(OH)C(OH)(C6H5)2 | |
| 100g | |
| 15, 1103 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O | |
| 366.45 | |
| 366.45 |
Chemical Identifiers
| 464-72-2 | |
| 366.45 | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 94766 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
| C26H22O2 | |
| MFCD00004448 | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| 1,1,2,2-tetraphenylethane-1,2-diol |
Safety and Handling
EINECSNumber : 207-356-8
RTECSNumber : KI2750000
TSCA : TSCA
RUO â Research Use Only