missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzopinacole, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 105590100
| Quantity | 10g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 464-72-2 | |
| 366.45 | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 94766 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
| C26H22O2 | |
| MFCD00004448 | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| 1,1,2,2-tetraphenylethane-1,2-diol |
Specifications
| Benzopinacole | |
| 464-72-2 | |
| 100.0 | |
| 97.5% min. (HPLC) | |
| C26H22O2 | |
| 10g | |
| 06, 1058 | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 1,1,2,2-tetraphenylethane-1,2-diol | |
| 94766 | |
| 98% |
| 98% | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| (C6H5)2C(OH)C(OH)(C6H5)2 | |
| MFCD00004448 | |
| 15, 1103 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O | |
| 366.45 | |
| 366.45 |
Safety and Handling
EINECSNumber : 207-356-8
RTECSNumber : KI2750000
TSCA : TSCA