missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzhydryl chloride, 98%
CAS: 90-99-3 | C13H11Cl | 202.681 g/mol
$74.86 - $1004.45
Chemical Identifiers
| CAS | 90-99-3 |
|---|---|
| Molecular Formula | C13H11Cl |
| Molecular Weight (g/mol) | 202.681 |
| MDL Number | MFCD00000855 |
| InChI Key | ZDVDCDLBOLSVGM-UHFFFAOYSA-N |
| Synonym | benzhydryl chloride, chlorodiphenylmethane, chloromethylene dibenzene, diphenylchloromethane, diphenylmethyl chloride, benzene, 1,1'-chloromethylene bis, chloro phenyl methyl benzene, methane, chlorodiphenyl, unii-cn9n9ayv4b, 1,1'-chloromethylene bisbenzene |
| PubChem CID | 7035 |
| IUPAC Name | [chloro(phenyl)methyl]benzene |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2476414
|
Thermo Scientific Chemicals
B2476414 |
25 g |
Each for $74.86
|
|
|||||
|
AAB2476422
|
Thermo Scientific Chemicals
B2476422 |
100 g |
Each for $225.96
|
|
|||||
|
AAB2476436
|
Thermo Scientific Chemicals
B2476436 |
500 g |
Each for $1,004.45
|
|
|||||
Description
Benzhydryl chloride was used as initiator during the controlled radical polymerization of styrene catalyzed by ionic iron complex. It was also used as the starting reagent in the synthesis of trimethylhydroquinone derivatives.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsBenzhydryl chloride was used as initiator during the controlled radical polymerization of styrene catalyzed by ionic iron complex. It was also used as the starting reagent in the synthesis of trimethylhydroquinone derivatives.
Solubility
Insoluble in water.
Notes
Store in a tightly sealed container. Store away from oxidizing agents, bases.
Chemical Identifiers
| 90-99-3 | |
| 202.681 | |
| ZDVDCDLBOLSVGM-UHFFFAOYSA-N | |
| 7035 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl |
| C13H11Cl | |
| MFCD00000855 | |
| benzhydryl chloride, chlorodiphenylmethane, chloromethylene dibenzene, diphenylchloromethane, diphenylmethyl chloride, benzene, 1,1'-chloromethylene bis, chloro phenyl methyl benzene, methane, chlorodiphenyl, unii-cn9n9ayv4b, 1,1'-chloromethylene bisbenzene | |
| [chloro(phenyl)methyl]benzene |
Specifications
| 90-99-3 | |
| 1.14 | |
| 160°C (320°F) | |
| C13H11Cl | |
| MFCD00000855 | |
| UN3265 | |
| benzhydryl chloride, chlorodiphenylmethane, chloromethylene dibenzene, diphenylchloromethane, diphenylmethyl chloride, benzene, 1,1'-chloromethylene bis, chloro phenyl methyl benzene, methane, chlorodiphenyl, unii-cn9n9ayv4b, 1,1'-chloromethylene bisbenzene | |
| ZDVDCDLBOLSVGM-UHFFFAOYSA-N | |
| [chloro(phenyl)methyl]benzene | |
| 7035 | |
| 98% |
| 17°C to 20°C | |
| 139°C to 140°C (3 mmHg) | |
| Pungent | |
| 1.595 | |
| 25 g | |
| 607925 | |
| Insoluble in water. | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl | |
| 202.681 | |
| 202.69 | |
| Benzhydryl chloride |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P234-P260-P264b-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P390-P501c
H290-H314
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 202-031-7
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only