Learn More
Benzethonium chloride, 97%
Benzethonium chloride, 97%, C27H42ClNO2, CAS Number-121-54-0, benzethoniumchloride, benzethonium chloride, disilyn, hyamine, kylacol, phemeride, phemerol chloride, phemithyn, quatrachlor, solamin, 2.5kg, 96% min. (on dry substance) (Argentometry), 100.0, 96.0, CHEBI:31264, White, 204-479-9, 01,433 | CAS: 121-54-0 | C27H42ClNO2 | 448.08 g/mol
$123.94 - $401.28
Chemical Identifiers
| CAS | 121-54-0 |
|---|---|
| Molecular Formula | C27H42ClNO2 |
| Molecular Weight (g/mol) | 448.08 |
| MDL Number | MFCD00011742 |
| InChI Key | UREZNYTWGJKWBI-UHFFFAOYSA-M |
| Synonym | benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin |
| PubChem CID | 8478 |
| ChEBI | CHEBI:31264 |
| IUPAC Name | benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105381000
|
Thermo Scientific Chemicals
105381000 |
100 g | Plastic bottle |
Each for $123.94
|
|
||||
|
AC105385000
|
Thermo Scientific Chemicals
105385000 |
500 g | Plastic bottle |
Each for $401.28
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 121-54-0 | |
| 448.08 | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| 8478 | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |
| C27H42ClNO2 | |
| MFCD00011742 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| CHEBI:31264 | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
Specifications
| 121-54-0 | |
| 100.0 | |
| White | |
| Authentic | |
| Plastic bottle | |
| MFCD00011742 | |
| 01,433 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride | |
| 8478 | |
| 448.08 | |
| Amorphous or Crystalline Powder |
| 96.0 | |
| 158.0°C to 163.0°C | |
| 5% max. (105°C, 4 hrs) | |
| 96% min. (on dry substance) (Argentometry) | |
| C27H42ClNO2 | |
| 100 g | |
| 15, 1076 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol,acetone and chloroform | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] | |
| 448.08 | |
| CHEBI:31264 | |
| 97% | |
| Benzethonium chloride, 97% |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes severe skin burns and eye damage.
Very toxic to aquatic life.
GHS P Statement
Avoid release to the environment.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes
GHS Signal Word: Danger
EINECSNumber : 204-479-9
RTECSNumber : BO7175000
TSCA : TSCA
RUO – Research Use Only